C23H31N3OS — CID 125048125
1-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea (PubChem CID 125048125) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 125048125 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]-3-(4-propan-2-yloxyphenyl)thiourea |
| SMILES | CC(C)Oc1ccc(NC(=S)NCc2ccc(N3CCC[C@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H31N3OS/c1-17(2)27-22-12-8-20(9-13-22)25-23(28)24-15-19-6-10-21(11-7-19)26-14-4-5-18(3)16-26/h6-13,17-18H,4-5,14-16H2,1-3H3,(H2,24,25,28)/t18-/m0/s1 |
| InChIKey | FZTPLAGCHVQJMY-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|