C20H24FN3S — CID 100723971
1-(3-fluorophenyl)-3-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]thiourea (PubChem CID 100723971) has the molecular formula C20H24FN3S and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]thiourea.
| Compound Name | 1-(3-fluorophenyl)-3-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100723971 |
| Molecular Formula | C20H24FN3S |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[[4-[(3S)-3-methylpiperidin-1-yl]phenyl]methyl]thiourea |
| SMILES | C[C@H]1CCCN(c2ccc(CNC(=S)Nc3cccc(F)c3)cc2)C1 |
| InChI | InChI=1S/C20H24FN3S/c1-15-4-3-11-24(14-15)19-9-7-16(8-10-19)13-22-20(25)23-18-6-2-5-17(21)12-18/h2,5-10,12,15H,3-4,11,13-14H2,1H3,(H2,22,23,25)/t15-/m0/s1 |
| InChIKey | MVMWQQGDZDJUDL-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|