C18H20FN3S — CID 100626443
1-(4-fluorophenyl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 100626443) has the molecular formula C18H20FN3S and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100626443 |
| Molecular Formula | C18H20FN3S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NCc2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C18H20FN3S/c19-15-5-7-16(8-6-15)21-18(23)20-13-14-3-9-17(10-4-14)22-11-1-2-12-22/h3-10H,1-2,11-13H2,(H2,20,21,23) |
| InChIKey | PXYFKOBBMNQTPU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|