C27H39N7S — CID 100783880
1-[4-(azepan-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 100783880) has the molecular formula C27H39N7S and a molecular weight of 493.73 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783880 |
| Molecular Formula | C27H39N7S |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(N2CCCC2)cc1)Nc1nc(N2CCCCCC2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C27H39N7S/c35-27(28-21-22-10-12-23(13-11-22)32-14-8-9-15-32)31-26-29-24(33-16-4-1-2-5-17-33)20-25(30-26)34-18-6-3-7-19-34/h10-13,20H,1-9,14-19,21H2,(H2,28,29,30,31,35) |
| InChIKey | FZFNKVUZJDFXMD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|