C24H28N8S2 — CID 100783839
1-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 100783839) has the molecular formula C24H28N8S2 and a molecular weight of 492.68 g/mol. Its IUPAC name is 1-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783839 |
| Molecular Formula | C24H28N8S2 |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1-(4-pyrimidin-2-ylsulfanyl-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(N2CCCC2)cc1)Nc1nc(Sc2ncccn2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C24H28N8S2/c33-23(27-17-18-6-8-19(9-7-18)31-12-1-2-13-31)30-22-28-20(32-14-3-4-15-32)16-21(29-22)34-24-25-10-5-11-26-24/h5-11,16H,1-4,12-15,17H2,(H2,27,28,29,30,33) |
| InChIKey | HHIZPQOWNFBQMR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|