C18H25N7S2 — CID 100775436
1-[4-(azepan-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-propan-2-ylthiourea (PubChem CID 100775436) has the molecular formula C18H25N7S2 and a molecular weight of 403.58 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 100775436 |
| Molecular Formula | C18H25N7S2 |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1nc(Sc2ncccn2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C18H25N7S2/c1-13(2)21-17(26)24-16-22-14(25-10-5-3-4-6-11-25)12-15(23-16)27-18-19-8-7-9-20-18/h7-9,12-13H,3-6,10-11H2,1-2H3,(H2,21,22,23,24,26) |
| InChIKey | JGFYPKXGOQYZTP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|