C22H31N7S2 — CID 100791282
1-cycloheptyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea (PubChem CID 100791282) has the molecular formula C22H31N7S2 and a molecular weight of 457.67 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cycloheptyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791282 |
| Molecular Formula | C22H31N7S2 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-cycloheptyl-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(Sc2ncccn2)nc(NC(=S)NC2CCCCCC2)n1 |
| InChI | InChI=1S/C22H31N7S2/c1-16-9-6-7-14-29(16)18-15-19(31-22-23-12-8-13-24-22)27-20(26-18)28-21(30)25-17-10-4-2-3-5-11-17/h8,12-13,15-17H,2-7,9-11,14H2,1H3,(H2,25,26,27,28,30)/t16-/m1/s1 |
| InChIKey | XZFSWAMUPBGTNV-MRXNPFEDSA-N |
| XLogP | 4.81 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|