C19H20N8S3 — CID 100791072
1-[4,6-bis(pyrimidin-2-ylsulfanyl)pyrimidin-2-yl]-3-cyclohexylthiourea (PubChem CID 100791072) has the molecular formula C19H20N8S3 and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-[4,6-bis(pyrimidin-2-ylsulfanyl)pyrimidin-2-yl]-3-cyclohexylthiourea.
| Compound Name | 1-[4,6-bis(pyrimidin-2-ylsulfanyl)pyrimidin-2-yl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 100791072 |
| Molecular Formula | C19H20N8S3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[4,6-bis(pyrimidin-2-ylsulfanyl)pyrimidin-2-yl]-3-cyclohexylthiourea |
| SMILES | S=C(Nc1nc(Sc2ncccn2)cc(Sc2ncccn2)n1)NC1CCCCC1 |
| InChI | InChI=1S/C19H20N8S3/c28-17(24-13-6-2-1-3-7-13)27-16-25-14(29-18-20-8-4-9-21-18)12-15(26-16)30-19-22-10-5-11-23-19/h4-5,8-13H,1-3,6-7H2,(H2,24,25,26,27,28) |
| InChIKey | IUXUEPHXBDXIJS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|