C18H29N5S — CID 100791095
1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-cyclohexylthiourea (PubChem CID 100791095) has the molecular formula C18H29N5S and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-cyclohexylthiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 100791095 |
| Molecular Formula | C18H29N5S |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-methylpyrimidin-2-yl]-3-cyclohexylthiourea |
| SMILES | Cc1cc(N2CCCCCC2)nc(NC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C18H29N5S/c1-14-13-16(23-11-7-2-3-8-12-23)21-17(19-14)22-18(24)20-15-9-5-4-6-10-15/h13,15H,2-12H2,1H3,(H2,19,20,21,22,24) |
| InChIKey | RQANNBNQOGVBPE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|