C21H34N6S — CID 100790916
1-cyclohexyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100790916) has the molecular formula C21H34N6S and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790916 |
| Molecular Formula | C21H34N6S |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-cyclohexyl-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(N2CCCC2)nc(NC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C21H34N6S/c1-16-9-5-6-14-27(16)19-15-18(26-12-7-8-13-26)23-20(24-19)25-21(28)22-17-10-3-2-4-11-17/h15-17H,2-14H2,1H3,(H2,22,23,24,25,28)/t16-/m0/s1 |
| InChIKey | LKMIRXXFJREQKA-INIZCTEOSA-N |
| XLogP | 4.07 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|