C18H28N6S — CID 100790392
1-cyclopropyl-3-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100790392) has the molecular formula C18H28N6S and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790392 |
| Molecular Formula | C18H28N6S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-cyclopropyl-3-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | S=C(Nc1nc(N2CCCCC2)cc(N2CCCCC2)n1)NC1CC1 |
| InChI | InChI=1S/C18H28N6S/c25-18(19-14-7-8-14)22-17-20-15(23-9-3-1-4-10-23)13-16(21-17)24-11-5-2-6-12-24/h13-14H,1-12H2,(H2,19,20,21,22,25) |
| InChIKey | WIFFHQRMDTVXRM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|