C19H30N6S — CID 100790400
1-cyclopropyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100790400) has the molecular formula C19H30N6S and a molecular weight of 374.56 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790400 |
| Molecular Formula | C19H30N6S |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-cyclopropyl-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCCC3)nc(NC(=S)NC3CC3)n2)C1 |
| InChI | InChI=1S/C19H30N6S/c1-14-6-5-11-25(13-14)17-12-16(24-9-3-2-4-10-24)21-18(22-17)23-19(26)20-15-7-8-15/h12,14-15H,2-11,13H2,1H3,(H2,20,21,22,23,26)/t14-/m1/s1 |
| InChIKey | KHOMBIKSXYTLTM-CQSZACIVSA-N |
| XLogP | 3.15 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|