C19H32N6S — CID 125048168
1-[4-[(3S)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-propan-2-ylthiourea (PubChem CID 125048168) has the molecular formula C19H32N6S and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 125048168 |
| Molecular Formula | C19H32N6S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[4-[(3S)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1nc(N2CCCCC2)cc(N2CCC[C@H](C)C2)n1 |
| InChI | InChI=1S/C19H32N6S/c1-14(2)20-19(26)23-18-21-16(24-9-5-4-6-10-24)12-17(22-18)25-11-7-8-15(3)13-25/h12,14-15H,4-11,13H2,1-3H3,(H2,20,21,22,23,26)/t15-/m0/s1 |
| InChIKey | IAQJJNXMQADLSU-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|