C14H22ClN5S — CID 100775606
1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-propan-2-ylthiourea (PubChem CID 100775606) has the molecular formula C14H22ClN5S and a molecular weight of 327.89 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 100775606 |
| Molecular Formula | C14H22ClN5S |
| Molecular Weight | 327.89 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1nc(Cl)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C14H22ClN5S/c1-10(2)16-14(21)19-13-17-11(15)9-12(18-13)20-7-5-3-4-6-8-20/h9-10H,3-8H2,1-2H3,(H2,16,17,18,19,21) |
| InChIKey | UCODUEIJFONHDE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|