C10H14ClN5S — CID 100773732
1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-methylthiourea (PubChem CID 100773732) has the molecular formula C10H14ClN5S and a molecular weight of 271.78 g/mol. Its IUPAC name is 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-methylthiourea.
| Compound Name | 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-methylthiourea |
|---|---|
| PubChem CID | 100773732 |
| Molecular Formula | C10H14ClN5S |
| Molecular Weight | 271.78 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1nc(Cl)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C10H14ClN5S/c1-12-10(17)15-9-13-7(11)6-8(14-9)16-4-2-3-5-16/h6H,2-5H2,1H3,(H2,12,13,14,15,17) |
| InChIKey | TUNKLBWNNYMOFG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.78 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|