C20H24ClN5O2S — CID 100791970
1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea (PubChem CID 100791970) has the molecular formula C20H24ClN5O2S and a molecular weight of 433.97 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100791970 |
| Molecular Formula | C20H24ClN5O2S |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-chloropyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccc2c(c1)OCCO2)Nc1nc(Cl)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C20H24ClN5O2S/c21-17-12-18(26-7-3-1-2-4-8-26)24-19(23-17)25-20(29)22-13-14-5-6-15-16(11-14)28-10-9-27-15/h5-6,11-12H,1-4,7-10,13H2,(H2,22,23,24,25,29) |
| InChIKey | ZZIIMWYYEKOAGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|