C21H26ClN5O2S — CID 100791959
1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea (PubChem CID 100791959) has the molecular formula C21H26ClN5O2S and a molecular weight of 447.99 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea.
| Compound Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100791959 |
| Molecular Formula | C21H26ClN5O2S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(Cl)nc(NC(=S)NCc3ccc4c(c3)OCCO4)n2)C1 |
| InChI | InChI=1S/C21H26ClN5O2S/c1-13-7-14(2)12-27(11-13)19-9-18(22)24-20(25-19)26-21(30)23-10-15-3-4-16-17(8-15)29-6-5-28-16/h3-4,8-9,13-14H,5-7,10-12H2,1-2H3,(H2,23,24,25,26,30)/t13-,14-/m1/s1 |
| InChIKey | DXCYKTJERLANCC-ZIAGYGMSSA-N |
| XLogP | 3.87 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|