C14H22ClN5S — CID 100774436
1-[4-chloro-6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-ethylthiourea (PubChem CID 100774436) has the molecular formula C14H22ClN5S and a molecular weight of 327.89 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-ethylthiourea.
| Compound Name | 1-[4-chloro-6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 100774436 |
| Molecular Formula | C14H22ClN5S |
| Molecular Weight | 327.89 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[4-chloro-6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc(Cl)cc(N2C[C@H](C)C[C@H](C)C2)n1 |
| InChI | InChI=1S/C14H22ClN5S/c1-4-16-14(21)19-13-17-11(15)6-12(18-13)20-7-9(2)5-10(3)8-20/h6,9-10H,4-5,7-8H2,1-3H3,(H2,16,17,18,19,21)/t9-,10+ |
| InChIKey | ORYLTGHAFNPOJL-AOOOYVTPSA-N |
| XLogP | 2.92 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|