C25H33Cl2N5S — CID 133178846
1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 133178846) has the molecular formula C25H33Cl2N5S and a molecular weight of 506.55 g/mol. Its IUPAC name is 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 133178846 |
| Molecular Formula | C25H33Cl2N5S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[4-chloro-6-(3,5-dimethylpiperidin-1-yl)pyrimidin-2-yl]-3-[[1-(4-chlorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(Cl)nc(NC(=S)NCC3(c4ccc(Cl)cc4)CCCCC3)n2)C1 |
| InChI | InChI=1S/C25H33Cl2N5S/c1-17-12-18(2)15-32(14-17)22-13-21(27)29-23(30-22)31-24(33)28-16-25(10-4-3-5-11-25)19-6-8-20(26)9-7-19/h6-9,13,17-18H,3-5,10-12,14-16H2,1-2H3,(H2,28,29,30,31,33) |
| InChIKey | QKIXAPVZNKUIFC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|