C26H36FN5S — CID 133178914
1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 133178914) has the molecular formula C26H36FN5S and a molecular weight of 469.67 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 133178914 |
| Molecular Formula | C26H36FN5S |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | Cc1cc(N2CC(C)CC(C)C2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C26H36FN5S/c1-18-13-19(2)16-32(15-18)23-14-20(3)29-24(30-23)31-25(33)28-17-26(11-5-4-6-12-26)21-7-9-22(27)10-8-21/h7-10,14,18-19H,4-6,11-13,15-17H2,1-3H3,(H2,28,29,30,31,33) |
| InChIKey | LIBIGUURYSQZSS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|