C28H39FN6O2S — CID 100790140
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea (PubChem CID 100790140) has the molecular formula C28H39FN6O2S and a molecular weight of 542.73 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100790140 |
| Molecular Formula | C28H39FN6O2S |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NCC3(c4ccc(F)cc4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C28H39FN6O2S/c1-20-15-21(2)18-35(17-20)25-16-24(34-9-13-37-14-10-34)31-26(32-25)33-27(38)30-19-28(7-11-36-12-8-28)22-3-5-23(29)6-4-22/h3-6,16,20-21H,7-15,17-19H2,1-2H3,(H2,30,31,32,33,38)/t20-,21-/m1/s1 |
| InChIKey | YRPXITLCCHDLGG-NHCUHLMSSA-N |
| XLogP | 3.97 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|