C22H28FN5O3S — CID 100790053
1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)thiourea (PubChem CID 100790053) has the molecular formula C22H28FN5O3S and a molecular weight of 461.56 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100790053 |
| Molecular Formula | C22H28FN5O3S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-methoxy-6-morpholin-4-ylpyrimidin-2-yl)thiourea |
| SMILES | COc1cc(N2CCOCC2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C22H28FN5O3S/c1-29-19-14-18(28-8-12-31-13-9-28)25-20(26-19)27-21(32)24-15-22(6-10-30-11-7-22)16-2-4-17(23)5-3-16/h2-5,14H,6-13,15H2,1H3,(H2,24,25,26,27,32) |
| InChIKey | QNOXIRJQVBGIII-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|