C26H35ClN6O2S — CID 100789513
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-morpholin-4-yl-6-piperidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100789513) has the molecular formula C26H35ClN6O2S and a molecular weight of 531.13 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-morpholin-4-yl-6-piperidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-morpholin-4-yl-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100789513 |
| Molecular Formula | C26H35ClN6O2S |
| Molecular Weight | 531.13 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-morpholin-4-yl-6-piperidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCOCC1)Nc1nc(N2CCCCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H35ClN6O2S/c27-21-6-4-20(5-7-21)26(8-14-34-15-9-26)19-28-25(36)31-24-29-22(32-10-2-1-3-11-32)18-23(30-24)33-12-16-35-17-13-33/h4-7,18H,1-3,8-17,19H2,(H2,28,29,30,31,36) |
| InChIKey | RGYJQGXNTDMRKH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.13 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|