C27H37ClN6O2S — CID 133178963
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 133178963) has the molecular formula C27H37ClN6O2S and a molecular weight of 545.15 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133178963 |
| Molecular Formula | C27H37ClN6O2S |
| Molecular Weight | 545.15 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3-methylpiperidin-1-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCOCC3)nc(NC(=S)NCC3(c4ccc(Cl)cc4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C27H37ClN6O2S/c1-20-3-2-10-34(18-20)24-17-23(33-11-15-36-16-12-33)30-25(31-24)32-26(37)29-19-27(8-13-35-14-9-27)21-4-6-22(28)7-5-21/h4-7,17,20H,2-3,8-16,18-19H2,1H3,(H2,29,30,31,32,37) |
| InChIKey | FPGNSFJGRQGULM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|