C29H34ClN5O2S — CID 100789607
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 100789607) has the molecular formula C29H34ClN5O2S and a molecular weight of 552.14 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789607 |
| Molecular Formula | C29H34ClN5O2S |
| Molecular Weight | 552.14 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(Oc3ccccc3)nc(NC(=S)NCC3(c4ccc(Cl)cc4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C29H34ClN5O2S/c1-21-6-5-15-35(19-21)25-18-26(37-24-7-3-2-4-8-24)33-27(32-25)34-28(38)31-20-29(13-16-36-17-14-29)22-9-11-23(30)12-10-22/h2-4,7-12,18,21H,5-6,13-17,19-20H2,1H3,(H2,31,32,33,34,38)/t21-/m1/s1 |
| InChIKey | HVQXXTXZWDYGOZ-OAQYLSRUSA-N |
| XLogP | 6.19 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.14 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|