C29H35N5OS — CID 133179296
1-[4-(3-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 133179296) has the molecular formula C29H35N5OS and a molecular weight of 501.70 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 133179296 |
| Molecular Formula | C29H35N5OS |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-phenoxypyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | CC1CCCN(c2cc(Oc3ccccc3)nc(NC(=S)NCC3(c4ccccc4)CCCC3)n2)C1 |
| InChI | InChI=1S/C29H35N5OS/c1-22-11-10-18-34(20-22)25-19-26(35-24-14-6-3-7-15-24)32-27(31-25)33-28(36)30-21-29(16-8-9-17-29)23-12-4-2-5-13-23/h2-7,12-15,19,22H,8-11,16-18,20-21H2,1H3,(H2,30,31,32,33,36) |
| InChIKey | WVYOEOZHLADTFW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|