C29H34FN5OS — CID 100787168
1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea (PubChem CID 100787168) has the molecular formula C29H34FN5OS and a molecular weight of 519.69 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100787168 |
| Molecular Formula | C29H34FN5OS |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-phenoxypyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(Oc3ccccc3)nc(NC(=S)NCC3(c4ccc(F)cc4)CCCC3)n2)C1 |
| InChI | InChI=1S/C29H34FN5OS/c1-21-8-7-17-35(19-21)25-18-26(36-24-9-3-2-4-10-24)33-27(32-25)34-28(37)31-20-29(15-5-6-16-29)22-11-13-23(30)14-12-22/h2-4,9-14,18,21H,5-8,15-17,19-20H2,1H3,(H2,31,32,33,34,37)/t21-/m1/s1 |
| InChIKey | CZZMSLQWSCZELC-OAQYLSRUSA-N |
| XLogP | 6.44 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|