C29H41FN6S — CID 100787143
1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea (PubChem CID 100787143) has the molecular formula C29H41FN6S and a molecular weight of 524.75 g/mol. Its IUPAC name is 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 100787143 |
| Molecular Formula | C29H41FN6S |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCC[C@@H](C)C3)nc(NC(=S)NCC3(c4ccc(F)cc4)CCCC3)n2)C1 |
| InChI | InChI=1S/C29H41FN6S/c1-21-7-5-15-35(18-21)25-17-26(36-16-6-8-22(2)19-36)33-27(32-25)34-28(37)31-20-29(13-3-4-14-29)23-9-11-24(30)12-10-23/h9-12,17,21-22H,3-8,13-16,18-20H2,1-2H3,(H2,31,32,33,34,37)/t21-,22-/m1/s1 |
| InChIKey | ZQCBFVMLQWSSFO-FGZHOGPDSA-N |
| XLogP | 5.89 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|