C31H38N6S — CID 100786356
1-[4-(1,3-dihydroisoindol-2-yl)-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786356) has the molecular formula C31H38N6S and a molecular weight of 526.75 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786356 |
| Molecular Formula | C31H38N6S |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(N3Cc4ccccc4C3)nc(NC(=S)NCC3(c4ccccc4)CCCC3)n2)C1 |
| InChI | InChI=1S/C31H38N6S/c1-23-10-9-17-36(19-23)27-18-28(37-20-24-11-5-6-12-25(24)21-37)34-29(33-27)35-30(38)32-22-31(15-7-8-16-31)26-13-3-2-4-14-26/h2-6,11-14,18,23H,7-10,15-17,19-22H2,1H3,(H2,32,33,34,35,38)/t23-/m0/s1 |
| InChIKey | SOMGZAOFHVLTKI-QHCPKHFHSA-N |
| XLogP | 6.03 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|