C31H37ClN6OS — CID 133179016
1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133179016) has the molecular formula C31H37ClN6OS and a molecular weight of 577.20 g/mol. Its IUPAC name is 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133179016 |
| Molecular Formula | C31H37ClN6OS |
| Molecular Weight | 577.20 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(N3Cc4ccccc4C3)nc(NC(=S)NCC3(c4cccc(Cl)c4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C31H37ClN6OS/c1-22-6-5-13-37(18-22)27-17-28(38-19-23-7-2-3-8-24(23)20-38)35-29(34-27)36-30(40)33-21-31(11-14-39-15-12-31)25-9-4-10-26(32)16-25/h2-4,7-10,16-17,22H,5-6,11-15,18-21H2,1H3,(H2,33,34,35,36,40) |
| InChIKey | PFTHEYRMCMWAJO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.20 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|