C25H33ClN6OS — CID 100789777
1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100789777) has the molecular formula C25H33ClN6OS and a molecular weight of 501.10 g/mol. Its IUPAC name is 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100789777 |
| Molecular Formula | C25H33ClN6OS |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2cccc(Cl)c2)CCOCC1)Nc1nc(N2CCCC2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C25H33ClN6OS/c26-20-7-5-6-19(16-20)25(8-14-33-15-9-25)18-27-24(34)30-23-28-21(31-10-1-2-11-31)17-22(29-23)32-12-3-4-13-32/h5-7,16-17H,1-4,8-15,18H2,(H2,27,28,29,30,34) |
| InChIKey | XHSCPGHMCYHCDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|