C26H35ClN6OS — CID 100788580
1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100788580) has the molecular formula C26H35ClN6OS and a molecular weight of 515.13 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100788580 |
| Molecular Formula | C26H35ClN6OS |
| Molecular Weight | 515.13 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclohexyl]methyl]-3-(4-morpholin-4-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2cccc(Cl)c2)CCCCC1)Nc1nc(N2CCCC2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H35ClN6OS/c27-21-8-6-7-20(17-21)26(9-2-1-3-10-26)19-28-25(35)31-24-29-22(32-11-4-5-12-32)18-23(30-24)33-13-15-34-16-14-33/h6-8,17-18H,1-5,9-16,19H2,(H2,28,29,30,31,35) |
| InChIKey | TYXFHLAEBTYYBB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.13 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|