C27H30ClN5O2S — CID 100787543
1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea (PubChem CID 100787543) has the molecular formula C27H30ClN5O2S and a molecular weight of 524.09 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100787543 |
| Molecular Formula | C27H30ClN5O2S |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-(4-morpholin-4-yl-6-phenoxypyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2cccc(Cl)c2)CCCC1)Nc1nc(Oc2ccccc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C27H30ClN5O2S/c28-21-8-6-7-20(17-21)27(11-4-5-12-27)19-29-26(36)32-25-30-23(33-13-15-34-16-14-33)18-24(31-25)35-22-9-2-1-3-10-22/h1-3,6-10,17-18H,4-5,11-16,19H2,(H2,29,30,31,32,36) |
| InChIKey | QYLYXTRZIOZRFV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|