C33H42ClN7S — CID 100787646
1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(3-chlorophenyl)cyclopentyl]methyl]thiourea (PubChem CID 100787646) has the molecular formula C33H42ClN7S and a molecular weight of 604.27 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(3-chlorophenyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(3-chlorophenyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 100787646 |
| Molecular Formula | C33H42ClN7S |
| Molecular Weight | 604.27 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(3-chlorophenyl)cyclopentyl]methyl]thiourea |
| SMILES | S=C(NCC1(c2cccc(Cl)c2)CCCC1)Nc1nc(N2CCCCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C33H42ClN7S/c34-27-12-10-11-26(23-27)33(15-6-7-16-33)25-35-32(42)38-31-36-29(40-17-8-1-2-9-18-40)24-30(37-31)41-21-19-39(20-22-41)28-13-4-3-5-14-28/h3-5,10-14,23-24H,1-2,6-9,15-22,25H2,(H2,35,36,37,38,42) |
| InChIKey | PUUZKLIRRXGGBE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.27 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|