C28H39ClN6S — CID 100787482
1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100787482) has the molecular formula C28H39ClN6S and a molecular weight of 527.18 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100787482 |
| Molecular Formula | C28H39ClN6S |
| Molecular Weight | 527.18 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopentyl]methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCCC3)nc(NC(=S)NCC3(c4cccc(Cl)c4)CCCC3)n2)C1 |
| InChI | InChI=1S/C28H39ClN6S/c1-21-9-8-16-35(19-21)25-18-24(34-14-5-2-6-15-34)31-26(32-25)33-27(36)30-20-28(12-3-4-13-28)22-10-7-11-23(29)17-22/h7,10-11,17-18,21H,2-6,8-9,12-16,19-20H2,1H3,(H2,30,31,32,33,36)/t21-/m1/s1 |
| InChIKey | QVLKBTUYBJJPDC-OAQYLSRUSA-N |
| XLogP | 6.16 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.18 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|