C30H43ClN6OS — CID 100789923
1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[4-(3-chlorophenyl)oxan-4-yl]methyl]thiourea (PubChem CID 100789923) has the molecular formula C30H43ClN6OS and a molecular weight of 571.24 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[4-(3-chlorophenyl)oxan-4-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[4-(3-chlorophenyl)oxan-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100789923 |
| Molecular Formula | C30H43ClN6OS |
| Molecular Weight | 571.24 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[[4-(3-chlorophenyl)oxan-4-yl]methyl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)NCC3(c4cccc(Cl)c4)CCOCC3)n2)C1 |
| InChI | InChI=1S/C30H43ClN6OS/c1-22-16-23(2)20-37(19-22)27-18-26(36-12-5-3-4-6-13-36)33-28(34-27)35-29(39)32-21-30(10-14-38-15-11-30)24-8-7-9-25(31)17-24/h7-9,17-18,22-23H,3-6,10-16,19-21H2,1-2H3,(H2,32,33,34,35,39)/t22-,23-/m0/s1 |
| InChIKey | HQXUGNUGZPWCHW-GOTSBHOMSA-N |
| XLogP | 6.03 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.24 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|