C27H37ClN6OS — CID 100789790
1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100789790) has the molecular formula C27H37ClN6OS and a molecular weight of 529.15 g/mol. Its IUPAC name is 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789790 |
| Molecular Formula | C27H37ClN6OS |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(N2CCCC2)nc(NC(=S)NCC2(c3cccc(Cl)c3)CCOCC2)n1 |
| InChI | InChI=1S/C27H37ClN6OS/c1-20-7-2-3-14-34(20)24-18-23(33-12-4-5-13-33)30-25(31-24)32-26(36)29-19-27(10-15-35-16-11-27)21-8-6-9-22(28)17-21/h6,8-9,17-18,20H,2-5,7,10-16,19H2,1H3,(H2,29,30,31,32,36)/t20-/m0/s1 |
| InChIKey | BZBLZUVSKUOFGP-FQEVSTJZSA-N |
| XLogP | 5.14 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|