C33H42ClN7OS — CID 100789901
1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100789901) has the molecular formula C33H42ClN7OS and a molecular weight of 620.27 g/mol. Its IUPAC name is 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789901 |
| Molecular Formula | C33H42ClN7OS |
| Molecular Weight | 620.27 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 1-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCCN1c1cc(N2CCN(c3ccccc3)CC2)nc(NC(=S)NCC2(c3cccc(Cl)c3)CCOCC2)n1 |
| InChI | InChI=1S/C33H42ClN7OS/c1-25-8-5-6-15-41(25)30-23-29(40-18-16-39(17-19-40)28-11-3-2-4-12-28)36-31(37-30)38-32(43)35-24-33(13-20-42-21-14-33)26-9-7-10-27(34)22-26/h2-4,7,9-12,22-23,25H,5-6,8,13-21,24H2,1H3,(H2,35,36,37,38,43)/t25-/m1/s1 |
| InChIKey | LQXAYDCXAJIYRD-RUZDIDTESA-N |
| XLogP | 5.87 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.27 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|