C29H41ClN6OS — CID 133178980
1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea (PubChem CID 133178980) has the molecular formula C29H41ClN6OS and a molecular weight of 557.21 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 133178980 |
| Molecular Formula | C29H41ClN6OS |
| Molecular Weight | 557.21 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-chlorophenyl)oxan-4-yl]methyl]thiourea |
| SMILES | CC1CCCCN1c1cc(N2CCCCCC2)nc(NC(=S)NCC2(c3ccc(Cl)cc3)CCOCC2)n1 |
| InChI | InChI=1S/C29H41ClN6OS/c1-22-8-4-7-17-36(22)26-20-25(35-15-5-2-3-6-16-35)32-27(33-26)34-28(38)31-21-29(13-18-37-19-14-29)23-9-11-24(30)12-10-23/h9-12,20,22H,2-8,13-19,21H2,1H3,(H2,31,32,33,34,38) |
| InChIKey | FCLPZGOHVJBXFB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.21 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|