C21H25Cl2N5OS — CID 100789724
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100789724) has the molecular formula C21H25Cl2N5OS and a molecular weight of 466.44 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100789724 |
| Molecular Formula | C21H25Cl2N5OS |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-(4-chloro-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCOCC1)Nc1nc(Cl)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C21H25Cl2N5OS/c22-16-5-3-15(4-6-16)21(7-11-29-12-8-21)14-24-20(30)27-19-25-17(23)13-18(26-19)28-9-1-2-10-28/h3-6,13H,1-2,7-12,14H2,(H2,24,25,26,27,30) |
| InChIKey | SNHUUYNABKPZIT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|