C26H35FN6OS — CID 100790073
1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea (PubChem CID 100790073) has the molecular formula C26H35FN6OS and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100790073 |
| Molecular Formula | C26H35FN6OS |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-3-(4-piperidin-1-yl-6-pyrrolidin-1-ylpyrimidin-2-yl)thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(N4CCCCC4)cc(N4CCCC4)n3)CCOCC2)cc1 |
| InChI | InChI=1S/C26H35FN6OS/c27-21-8-6-20(7-9-21)26(10-16-34-17-11-26)19-28-25(35)31-24-29-22(32-12-2-1-3-13-32)18-23(30-24)33-14-4-5-15-33/h6-9,18H,1-5,10-17,19H2,(H2,28,29,30,31,35) |
| InChIKey | WYIWWSZAEKMMMV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|