C31H38N6OS — CID 100789403
1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789403) has the molecular formula C31H38N6OS and a molecular weight of 542.75 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789403 |
| Molecular Formula | C31H38N6OS |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCOCC1)Nc1nc(N2CCCCCC2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C31H38N6OS/c39-30(32-23-31(14-18-38-19-15-31)26-12-4-3-5-13-26)35-29-33-27(36-16-8-1-2-9-17-36)20-28(34-29)37-21-24-10-6-7-11-25(24)22-37/h3-7,10-13,20H,1-2,8-9,14-19,21-23H2,(H2,32,33,34,35,39) |
| InChIKey | UMISKJXJVYCXOK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|