C27H37FN6OS — CID 100790102
1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea (PubChem CID 100790102) has the molecular formula C27H37FN6OS and a molecular weight of 512.70 g/mol. Its IUPAC name is 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea.
| Compound Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100790102 |
| Molecular Formula | C27H37FN6OS |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(N4CCCCC4)cc(N4CCCCC4)n3)CCOCC2)cc1 |
| InChI | InChI=1S/C27H37FN6OS/c28-22-9-7-21(8-10-22)27(11-17-35-18-12-27)20-29-26(36)32-25-30-23(33-13-3-1-4-14-33)19-24(31-25)34-15-5-2-6-16-34/h7-10,19H,1-6,11-18,20H2,(H2,29,30,31,32,36) |
| InChIKey | ADBWWALLGTZKRX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|