C37H43FN8S — CID 100787213
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea (PubChem CID 100787213) has the molecular formula C37H43FN8S and a molecular weight of 650.87 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
|---|---|
| PubChem CID | 100787213 |
| Molecular Formula | C37H43FN8S |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclopentyl]methyl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(N4CCN(c5ccccc5)CC4)cc(N4CCN(c5ccccc5)CC4)n3)CCCC2)cc1 |
| InChI | InChI=1S/C37H43FN8S/c38-30-15-13-29(14-16-30)37(17-7-8-18-37)28-39-36(47)42-35-40-33(45-23-19-43(20-24-45)31-9-3-1-4-10-31)27-34(41-35)46-25-21-44(22-26-46)32-11-5-2-6-12-32/h1-6,9-16,27H,7-8,17-26,28H2,(H2,39,40,41,42,47) |
| InChIKey | MTVGXZIXNBTEQO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|