C32H40ClN7S — CID 100786620
1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100786620) has the molecular formula C32H40ClN7S and a molecular weight of 590.24 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100786620 |
| Molecular Formula | C32H40ClN7S |
| Molecular Weight | 590.24 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopentyl]methyl]-3-[4-(4-phenylpiperazin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCCC1)Nc1nc(N2CCCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C32H40ClN7S/c33-26-13-11-25(12-14-26)32(15-5-6-16-32)24-34-31(41)37-30-35-28(39-17-7-2-8-18-39)23-29(36-30)40-21-19-38(20-22-40)27-9-3-1-4-10-27/h1,3-4,9-14,23H,2,5-8,15-22,24H2,(H2,34,35,36,37,41) |
| InChIKey | RRRGNNBFUSIDPD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.24 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|