C34H45N7S — CID 100787979
1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea (PubChem CID 100787979) has the molecular formula C34H45N7S and a molecular weight of 583.85 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 100787979 |
| Molecular Formula | C34H45N7S |
| Molecular Weight | 583.85 g/mol |
| Exact Mass | 583.35 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(1-phenylcyclohexyl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCCCC1)Nc1nc(N2CCCCCC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C34H45N7S/c42-33(35-27-34(18-10-5-11-19-34)28-14-6-3-7-15-28)38-32-36-30(40-20-12-1-2-13-21-40)26-31(37-32)41-24-22-39(23-25-41)29-16-8-4-9-17-29/h3-4,6-9,14-17,26H,1-2,5,10-13,18-25,27H2,(H2,35,36,37,38,42) |
| InChIKey | VQDXIGCGNGOEND-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|