C29H34N6S — CID 100786271
1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786271) has the molecular formula C29H34N6S and a molecular weight of 498.70 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786271 |
| Molecular Formula | C29H34N6S |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCCC1)Nc1nc(N2CCCC2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C29H34N6S/c36-28(30-21-29(14-6-7-15-29)24-12-2-1-3-13-24)33-27-31-25(34-16-8-9-17-34)18-26(32-27)35-19-22-10-4-5-11-23(22)20-35/h1-5,10-13,18H,6-9,14-17,19-21H2,(H2,30,31,32,33,36) |
| InChIKey | DUUNUJCAESUJSH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|