C29H29N7S2 — CID 100786421
1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea (PubChem CID 100786421) has the molecular formula C29H29N7S2 and a molecular weight of 539.73 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
|---|---|
| PubChem CID | 100786421 |
| Molecular Formula | C29H29N7S2 |
| Molecular Weight | 539.73 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(1-phenylcyclopentyl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCCC1)Nc1nc(Sc2ncccn2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C29H29N7S2/c37-27(32-20-29(13-6-7-14-29)23-11-2-1-3-12-23)35-26-33-24(36-18-21-9-4-5-10-22(21)19-36)17-25(34-26)38-28-30-15-8-16-31-28/h1-5,8-12,15-17H,6-7,13-14,18-20H2,(H2,32,33,34,35,37) |
| InChIKey | AUPUXKBKQONGRI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|