C26H27ClFN5S — CID 100789166
1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 100789166) has the molecular formula C26H27ClFN5S and a molecular weight of 496.06 g/mol. Its IUPAC name is 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 100789166 |
| Molecular Formula | C26H27ClFN5S |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-[4-chloro-6-(1,3-dihydroisoindol-2-yl)pyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | Fc1ccc(C2(CNC(=S)Nc3nc(Cl)cc(N4Cc5ccccc5C4)n3)CCCCC2)cc1 |
| InChI | InChI=1S/C26H27ClFN5S/c27-22-14-23(33-15-18-6-2-3-7-19(18)16-33)31-24(30-22)32-25(34)29-17-26(12-4-1-5-13-26)20-8-10-21(28)11-9-20/h2-3,6-11,14H,1,4-5,12-13,15-17H2,(H2,29,30,31,32,34) |
| InChIKey | GVEPCJOMFMCSKG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|