C27H30FN5OS — CID 100788870
1-[4-(1,3-dihydroisoindol-2-yl)-6-methoxypyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea (PubChem CID 100788870) has the molecular formula C27H30FN5OS and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-methoxypyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-methoxypyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 100788870 |
| Molecular Formula | C27H30FN5OS |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-methoxypyrimidin-2-yl]-3-[[1-(4-fluorophenyl)cyclohexyl]methyl]thiourea |
| SMILES | COc1cc(N2Cc3ccccc3C2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C27H30FN5OS/c1-34-24-15-23(33-16-19-7-3-4-8-20(19)17-33)30-25(31-24)32-26(35)29-18-27(13-5-2-6-14-27)21-9-11-22(28)12-10-21/h3-4,7-12,15H,2,5-6,13-14,16-18H2,1H3,(H2,29,30,31,32,35) |
| InChIKey | WQPJPDHCQWSYIN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|